Organic phosphoric acids and derivatives
eMolecules 171557-31-6 | 2-(Bis(2-(tert-butoxy)-2-oxoethyl)amino)acetic acid | MFCD09833730 | 1g
Ambeed | 2-Methylbenzo[d]thiazole-5-carboxylic acid | 100mg | 521431636 | A271483 | 24851-69-2 | MFCD00498510 | 193.220 | C9H7NO2S
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 174677-83-9 | (1S,2S)-N1,N1-Bis(2-(diphenylphosphino)benzyl)cyclohexane-1,2-diamine | MFCD17014022 | 1g
Ambeed | 9-Phenyl-9H-fluoren-9-ol | 1g | 490549004 | A280706 | 25603-67-2 | MFCD00037121 | 258.320 | C19H14O
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 70476-82-3 | Mitoxantrone 2HCl | Ambeed | MFCD00242943 | 517.400 | C22H30Cl2N4O6 | 98.000 | Cl.Cl.OCCNCCNc1ccc(NCCNCCO)c2C(=O)c3c(O)ccc(O)c3C(=O)c12 | 1mg | 650568223
Mitoxantrone 2HCl | Ambeed | 70476-82-3 | MFCD00242943 | 517.400 | C22H30Cl2N4O6 | 98.000 | Cl.Cl.OCCNCCNc1ccc(NCCNCCO)c2C(=O)c3c(O)ccc(O)c3C(=O)c12 | 1mg | 650568223
Medchemexpress LLC Diethyl phosphate-13C4 sodium | 1329613-90-2 | >95.0% | 180.05 | 13C4H10NaO4P | 1mg
Diethyl phosphate-13C4 (sodium) is the 13C labeled isotope of Diethyl phosphate-13C4 (sodium)(HY-101417) Diethylphosphate (DEP) is product of metabolism and of environmental degradation of a commonly used insecticide Chlorpyrifos[1]
eMolecules 65094-22-6 | Diethyl (bromodifluoromethyl)phosphonate | Ochem Incorporation | MFCD00069118 | 267.007 | C5H10BrF2O3P | 98.000 | CCOP(=O)(OCC)C(F)(F)Br | 1g | 773126750
Diethyl (bromodifluoromethyl)phosphonate | Ochem Incorporation | 65094-22-6 | MFCD00069118 | 267.007 | C5H10BrF2O3P | 98.000 | CCOP(=O)(OCC)C(F)(F)Br | 1g | 773126750
eMolecules 4488-22-6 | rac-BINAM | Ambeed | MFCD00145204 | 284.362 | C20H16N2 | 97.000 | Nc1ccc2ccccc2c1-c1c(N)ccc2ccccc12 | 10g | 525131484
rac-BINAM | Ambeed | 4488-22-6 | MFCD00145204 | 284.362 | C20H16N2 | 97.000 | Nc1ccc2ccccc2c1-c1c(N)ccc2ccccc12 | 10g | 525131484
Medchemexpress LLC Sodium phenyl phosphate (dihydrate) | 66778-08-3 | MFCD00149080 | 10g
Sodium phenyl phosphate dihydrate can be used as a buffering agent in biochemical and pharmaceutical formulations Sodium phenyl phosphate dehydrate also acts as a substrate for evaluating phosphataseactivity[1]
eMolecules 108549-23-1 | Dibenzyl N,N-Diisopropylphosphoramidite | Accela ChemBio (ASD) | MFCD00191988 | 345.423 | C20H28NO2P | 95.000 | CC(C)N(C(C)C)P(OCc1ccccc1)OCc1ccccc1 | 10g | 485060881
Dibenzyl N,N-Diisopropylphosphoramidite | Accela ChemBio (ASD) | 108549-23-1 | MFCD00191988 | 345.423 | C20H28NO2P | 95.000 | CC(C)N(C(C)C)P(OCc1ccccc1)OCc1ccccc1 | 10g | 485060881
Medchemexpress LLC Riboflavin phosphate (sodium) | 130-40-5 | 1 ML
Riboflavin phosphate sodium (FMN-Na) is a derivative of Riboflavin (vitamin B2), an essential nutrient for animals. It acts as a very effective NAD+-recycling agent and is utilized in various research applications, including studies on progressive keratoconus, corneal ectasia, and irregular astigmatism. This compound enables good yields of cyclohexanone product and high levels of NAP turnover.
- Derivative of Riboflavin (vitamin B2)
- Essential nutrient for animals
- Used in research for progressive keratoconus, corneal ectasia, and irregular astigmatism
- Effective NAD+-recycling agent
- Enables good yields of cyclohexanone product and high levels of NAP turnover
eMolecules 65094-22-6 | Diethyl (bromodifluoromethyl)phosphonate | Chem-Impex | MFCD00069118 | 267.007 | C5H10BrF2O3P | 96.000 | CCOP(=O)(OCC)C(F)(F)Br | 25g | 603112662
Diethyl (bromodifluoromethyl)phosphonate | Chem-Impex | 65094-22-6 | MFCD00069118 | 267.007 | C5H10BrF2O3P | 96.000 | CCOP(=O)(OCC)C(F)(F)Br | 25g | 603112662
eMolecules 108549-23-1 | Dibenzyl N,N-Diisopropylphosphoramidite | Accela ChemBio (ASD) | MFCD00191988 | 345.423 | C20H28NO2P | 95.000 | CC(C)N(C(C)C)P(OCc1ccccc1)OCc1ccccc1 | 5g | 448669937
Dibenzyl N,N-Diisopropylphosphoramidite | Accela ChemBio (ASD) | 108549-23-1 | MFCD00191988 | 345.423 | C20H28NO2P | 95.000 | CC(C)N(C(C)C)P(OCc1ccccc1)OCc1ccccc1 | 5g | 448669937
eMolecules 108549-23-1 | Dibenzyl N,N-Diisopropylphosphoramidite | Accela ChemBio (ASD) | MFCD00191988 | 345.423 | C20H28NO2P | 95.000 | CC(C)N(C(C)C)P(OCc1ccccc1)OCc1ccccc1 | 25g | 448669938
Dibenzyl N,N-Diisopropylphosphoramidite | Accela ChemBio (ASD) | 108549-23-1 | MFCD00191988 | 345.423 | C20H28NO2P | 95.000 | CC(C)N(C(C)C)P(OCc1ccccc1)OCc1ccccc1 | 25g | 448669938